Name the following ionic compound: FePO4 Name the compound CH3CH2CH2CH2CH2CH3 Give the name of the compound IF7. Determine the name of the compound H2S. Name the ionic compound for CrN. Name the following compound: CH_3CH_2CH(OCH_3)CH_3CH_2CH_2CH_3. ...
What is the correct name ofFe2O3? Compounds: A compound is made up of two or more elements and can be classified as either ionic or covalent. An ionic compound is formed by a cation and anion which are positively and negatively charged, respectively. On the other hand, a covalent compou...
Fe2O3 Question: Fe2O3 Rust: Fe2O3 Answer and Explanation:1 Fe2O3 Learn more about this topic: Naming Ionic Compounds | Rules, Formula & Examples from Chapter 5/ Lesson 25 176K In this lesson, learn how to identify ionic compound formulas and see the required steps fo...
Name each of the following ionic compounds. a. MgCl2 b. TiO2 c. NiBr3 Ionic compound: When ionic compounds are dissolved in water; they become soluble, whereas if they are dissolved in non-polar solvents; then they become insoluble. They have a high boiling point. Answer a...
Name the compound: 2,2-dimethylpentane. Give the name of the compound SCl6. Give the name of the compound: CdF_2. Correctly name the following compound: Ca3(PO3)2 Name the compound CH3-O-CH2-CH2-CH(-CH3)-C(=O)-OH Name the following compound: CH3CH2CCH. ...
What is the name of the compound? What is the name for the compound below? Which of the following is a nonpolar molecule? a. NH_4OH b. CaCO_3 c. CO_2 d. H(OH) How do you produce calcium oxide from calcium carbonate? What is the correct name for the compound Cr2O3?
Name of the following compound? (a) {eq}FeCl_3 \cdot 6H_2O. {/eq} Nomenclature of the chemical species The Nomenclature of the chemical species is the procedure of giving names to the chemical compounds following some specific set of rules. It is necessary in order to identify each and...
What is the chemical name of CH_3CH_2CH_2OCH_2CH_2CH_3? What is the IUPAC name for the chemical formula PBO2? What is the name for the compound MgBr2? What is the formula for aluminum bicarbonate? What is the chemical name of the following compound \text{AuF}_2 ?
(a) Name the compound: Au_2S_2O_3. (b) Identify it as an ionic compound, acid, or molecular compound. Name the following compound, and indicate whether it is ionic or molecular. NBr_3 What is the name of the ionic compound Fe2O3? What is the name of the ionic compoun...
Name the following compound, and indicate whether it is ionic or molecular. Y_2(SO_4)_3 Name the following ionic compound: FePO4 Name the ionic compound for Mg(NO_3)_2. Name the ionic compound for CuS. What is the name of the ionic compound Fe2O3? What is the name of the ioni...