Name the following compound. ClCH2CH2CH(Cl)CH3 Give the name of the compound B2F4. Give the name of the compound below. (Cr(NH3)5SO4)Cl Give the name of the compound XeO3. What is the systematic name for the compound shown below?
What is the correct name ofFe2O3? Compounds: A compound is made up of two or more elements and can be classified as either ionic or covalent. An ionic compound is formed by a cation and anion which are positively and negatively charged, respectively. On the other hand, a covalent compou...
Name the following alkanes. What is the chemical name for Fe2O3? What is the name of the compound CO? What is the IUPAC name of the three-carbon alkene? Write the name of the following Alkanes. What is the name of CaCO3? What is the mass of the carbon atoms in 433.42 g of pr...
These nanoparticles includ- ing CaO2, ZnO2, CuO2, MgO2, etc. are produced as the result of replacing metal ions with hydrogen atoms of H2O2. MO2 can cause a strong oxidation effect following their interaction with H 2O and generate H 2O2 under acidic ...
Name the compound: 2,2-dimethylpentane. Give the name of the compound SCl6. Give the name of the compound: CdF_2. Correctly name the following compound: Ca3(PO3)2 Name the compound CH3-O-CH2-CH2-CH(-CH3)-C(=O)-OH Name the following compound: CH3CH2CCH. ...
Fe2O3 Learn more about this topic: Naming Ionic Compounds | Rules, Formula & Examples from Chapter 5/ Lesson 25 176K In this lesson, learn how to identify ionic compound formulas and see the required steps for writing and naming ionic compounds through several examples. ...
Name of the following compound? (a) {eq}FeCl_3 \cdot 6H_2O. {/eq} Nomenclature of the chemical species The Nomenclature of the chemical species is the procedure of giving names to the chemical compounds following some specific set of rules. It is necessary in order to identify each and...
Name the following compound: CrI3 6H2O Tell whether the given compound is a phenol. Name the compound. What is the name of the ionic compound Fe2O3? What is the name of the ionic compound CuS? Name the compound CH3-O-CH2-CH2-CH(-CH3)-C(=O)-OH Give the name of the compound IB...
What is the chemical name of CH_3CH_2CH_2OCH_2CH_2CH_3? What is the IUPAC name for the chemical formula PBO2? What is the name for the compound MgBr2? What is the formula for aluminum bicarbonate? What is the chemical name of the following compound \text{AuF}_2 ?
Name the following compound, and indicate whether it is ionic or molecular. Na_2O Name the compound CH3-O-CH2-CH2-CH(-CH3)-C(=O)-OH Give the name of the compound SiO2. Give the name of the compound: K_2CO_3. Name the compound N2O3 H2O. ...