What is the formula for photosynthesis? Which are tautomers of 2-Hexanone? Between {Co(NH3)6}^3+ and {Co(NH3)6}^2+ which complex is stable and why? Which of the following is an example of a gas? a. sun b. leaf c
Write a line-angle formula. CH3CH2CHCHCH2CHCH3CH(CH3)2CH3 Which would have the smallest angle between PH4 or POH3? An angle measures 54 degrees. What is the measure of its complement? Convert the given Newman projection to the equivalent line-angle formula. ...
What is the pOH of an aqueous solution with a pH of 8.5? What is the pOH of an aqueous solution with a pH of 12.18? The pH of an HBr(aq) solution is 1.675. What are the pOH, H3O+, and OH- for this solution? What is the pH of a solution with pOH = 10? What is the pH...
NCERT solutions for CBSE and other state boards is a key requirement for students. Doubtnut helps with homework, doubts and solutions to all the questions. It has helped students get under AIR 100 in NEET & IIT JEE. Get PDF and video solutions of IIT-JEE Mains & Advanced previous year pap...
To find the pOH of the given aqueous solution, we will follow these steps:Step 1: Calculate the OH⁻ concentration We know that the ionic product constant of water (Kw) is given by the formula:\( Kw = (H^+)(OH^-) \)
The chemicalformula for waterusually is written as H2O, but another way to consider the formula is HOH, where a positively charged hydrogen ion (H+) is bonded to a negatively charged hydroxide ion (OH-). This means water has properties of both an acid and a base, where the properties es...
Lemon juice has a pH of around 2.0, ranging between 2 and 3. To put that in perspective, the pH ofbattery acid(sulfuric acid) is 1.0, while the pH of an apple is about 3.0. Vinegar (a weak acetic acid) has a pH comparable to lemon juice, around 2.2. The pH of soda is about ...
We are ready to use what we know about acids and bases to calculate the pH of various solutions. Before we do this, however, PH. There is a formula to find pH pH = -log [H + ] or pH = -log [H 3 O + ] – (brackets around a substance means that substances ...
Molarity is a concentration unit of moles of solute per liter of solution, meaning the moles of a sample are simply the product of the molar concentration and the volume in liters.Answer and Explanation: The molecular formula indicates the quantity of each atom in one molec...
What is the formula for the hydrogen ion? \ A.\ OH^-\ B.\ H_2O\ C.\ H_3O^+\ D.\ H^+What are the formula and name of H+ and I- in an aqueous solution?Name and write the formula of the ion that makes a solution acidic....