Write the name of the compound (NH4)2S2O3. Write the name of the following compound: A) Pb(MnO4)2 B) Fe2(CrO4)3. Write the name of the following compound CH3-C-(CH3)2-CH2-C-(CH2-CH3)2-CH2-CH2-OH. Write the name of the following compound: A) Zn(ClO4)2 B) ...
a) Cu l b) Fe S c) Ca(Cl O_4)_2 d) Pb Br_2 e) None of the above will be more soluble in acidic solution.Which compound is more soluble in an acidic solution than in a neutral solution? a) PbBr_2. b) CuCl. c) AgI. ...