Answer to: Name the following molecular compound: CS_2 By signing up, you'll get thousands of step-by-step solutions to your homework questions...
Name the compound CH3-O-CH2-CH2-CH(-CH3)-C(=O)-OH Name the following compound: CH_3OCH_2CH(CH_3)_2. Name this compound. CH_3CH_2CH_2CH_2OH-1-butan Give the proper name for the following com...
Name the complex ion: [Fe(H_2O)_4C_2O_4]^+. Give the systematic name of the given coordination compound. W(PPh3)6 Give the systematic name of this coordination compound. K3Fe(CN)6 Name the coordination compound K_3[CuF_6]. What...