Give the name of the compound N2O4. Give the name of the ionic compound Na2O. Give the chemical name of SO_3 and predict its molecular structure. Name the following compound: CrI3 6H2O Name the compound MgCl2 4H2O. 1. Name this compound CH2CH3-CH3 2. Name this compound CH3-CH=CH-CH...
Write the name of the following compound: A) Pb(MnO4)2 B) Fe2(CrO4)3. Write the name of the following compound CH3-C-(CH3)2-CH2-C-(CH2-CH3)2-CH2-CH2-OH. Write the name of the following compound: A) Zn(ClO4)2 B) (NH4)HCO3. Write the name of the following com...
What is the name for the compound MnO4-? Compound Versus Ion: Compounds are chemical combinations of elements resulting in a neutral particle. Ions are either elements that have gained or lost electrons or the chemical combination of elements resulting in a charged particle. For example, CO2is ...
Question: What is NaBr a compound name for? Ionic Compounds Ionic compounds are between positively charged ions and negatively charged ions. Na is sodium, which lost one electron to become Na+1. Br is bromine, which gained one electron to become Br-1. ...
1. A fibre for thermal bonding comprising semicrystalline random copolymers of propylene, 1-hexene and optionally another α-olefin, the amount of 1-hexene being from 0.75 to less 1.52 mol % with respect to the total weight of the copolymer, the copolymers possessing a value of melt flow rate...
The nonaqueous electrolyte contains a compound (I) represented by the following formula (I) LiO3S—R—SO3Li (wherein R represents a linear hydrocarbon group having 1 to 10 carbon atoms). When a BET specific surface area of the negative electrode mixture layer is represented by X (m2/g) ...
Name the following compound: Cu(OH)2 What is cupric sulfate? What is the name for the compound with the formula BaSO_4? What is the chemical name for CO? What is the name of CaCO3? What is the compound name for B2F2? What is the chemical name for Fe2O3?
Name the following compound: CH3CH2CCH. Give the name of the compound: Cu(OH)_2. Give the name of the compound P2S3. Name the compound NaOCl. Give the name of the compound IF7. Write the name of the compound (NH4)2SO3. Give the proper name of the compound Cu2SO3. ...
Chemistry is often called the "Central Science". Why do you think it has gotten this name? Chemistry: Chemistry refers to the study of matter, their composition, behavior, and their reactions with other components. It tells us about the constituents of matter, such as elem...
Compounds may be classified as either covalent or ionic compounds based on the nature of the chemical bonds present. The rules for naming compounds depend on the type of the compound whether covalent or ionic.Answer and Explanation: The names of the compounds are given below: A) Coppe...