Name the following compounds. Explain how the name was derived. Systematic Naming of Cycloalkanes 1) Identify the parent chain (i.e. the longest chain of carbon atoms) and name the compound based on it. 2) Number all carbon atoms in the parent chain starting from the group with t...
Give the name of the following compounds.Compound Nomenclature:The name of the compound can be determined by finding the number of the carbon atoms present in the parent chain and the substituents attached on the lowest possible position of the chain....
What is NaBr a compound name for? What is the oxidation number of manganese in KMnO4? What is the name of the compound with the formula PCl5? What is the IUPAC name of this compound? What is the name of the covalent compound N2O5? Which of the following species CANNOT function as an ...
Name the following compound, and indicate whether it is ionic or molecular. Na_2O What is the formula and name of the ionic compound that contains NH4 as the cation and C2 O4 with a plus 2 charge as the anion? What is the name of the ion with the formula NO2-?
What is the atomic mass of calcium carbonate? What is calcium oxide? What is the name of the following compound: CaCl What is the formula for calcium oxide? What is the name of the compound Ca(NO3)2 ? What type of compound is calcium oxide?
Give the name for each of the following compounds Ca(MnO4)2 CrCl3 Compounds : Compound is made up of two or more different atoms that are chemically combined together in a fixed ratio. Atoms combined to form molecule and different molecules combined to form a compound. Few e...
Name the following compound: CrI3 6H2O Tell whether the given compound is a phenol. Name the compound. What is the name of the ionic compound Fe2O3? What is the name of the ionic compound CuS? Name the compound CH3-O-CH2-CH2-CH(-CH3)-C(=O)-OH Give the name of the compound IB...
Give the name of the compound SO3. Provide the name of the compound N2O5. Name the following compound: CH3CH2CCH. Give the name of the compound NO2. Name the compound: 2,3,5-trimethylhexane. Give the name of the compound IF7. Name the compound: 2,2-dimethylpentane. Name the follow...
a. The given compound is ketone having {eq}\rm (-CO group) {/eq}, So the suffix 'one' is used. Here, a long carbon chain has six... Learn more about this topic: IUPAC Naming for Organic Compounds | Rules, Process & Examples ...
Give the name for each of the following: (a) SiF4 (b) CuBr2 (c) MgCO3 (d) NH4NO3 Molecular name: There are some standards for naming a chemical compound. Some suffixes and prefixes are used for naming a compound. This naming gives uniqueness to the compound so ...