Write the name and formula of the compound formed between K+ and HCO3- ions. What is the name of the acid with the formula H2CO3? Write the formulas of the two anions derived from it and name these ions. Name each of the following polyatomic ions. a. HCO3- b. C2H3O2- c. CN- ...
Write the name of the following compound: A) Pb(MnO4)2 B) Fe2(CrO4)3. Write the name of the following compound CH3-C-(CH3)2-CH2-C-(CH2-CH3)2-CH2-CH2-OH. Write the name of the following compound: A) Zn(ClO4)2 B) (NH4)HCO3. Write the name of the following com...
Give the name and formula of the acid derived from the following anion: H2Po4- Determine the chemical formula and the chemical name of the ionic compound formed from the ions F e 2 + and O H . Give the name of HF as an acid and as a binary compound. Give the name and formula...
Give the name for each of the following: (a) SiF4 (b) CuBr2 (c) MgCO3 (d) NH4NO3 Molecular name: There are some standards for naming a chemical compound. Some suffixes and prefixes are used for naming a compound. This naming gives uniqueness to the compound so ...
What is the name and structure of the gas produced in the reaction between calcium carbide and water? Correctly name the following compound: Ca3(PO3)2 Name the compound that is used to test carbon (iv) oxide. Give the name of the compound: K_2CO_3. What is the name of the oxoanion...
Name the characteristic group it contains. What property makes the simple amines unpopular? What would be the chemical formula for Lithium Oxide? What would be the chemical formula for Diphosphorus Pentoxide? Answer the following question. What is a compound? Give three examples. Which of these ...
What is the IUPAC name for the following compound? a) 4-methyl-1-penten-2-ol b) 2-methyl-4-penten-2-ol c) 4-methyl-1-penten-4-ol d) 4-hydroxy-4-methyl-1-pentene e) 4-penten-2-methyl-2-ol Write the IUPAC name of the following alkanes: 1. (CH 3 ) 3 -C-CH 2...
A compound known as cubic boron nitride has a similar structure to that of a diamond. What properties do you expect it to have?What is the formula for the common household compound known as table salt?Name each of the following ternary ionic compou...
Write the name and chemical formula of the following compound containing Sodium and Oxygen. Write the name and charge of the cation. Write the name and charge of the anion Write the formula for the polyatomic ion in (NH4)2S. Write the names and formulas for the ...
Methyl red has the following structure: What is the color change and the pH at the color change when a weak base is titrated with a strong acid using methyl red as an indicator? For which of these two types of titrations is methyl red a possible indicator ...