Iupac Name:2-methylpropyl propanoateCAS No.: 540-42-1Molecular Weight:130.187Modify Date.: 2022-11-06 08:23Introduction: Isobutyl propionate, with the chemical formula C7H14O2 and CAS registry number 540-42-1, is a compound known for its applications in various industries. This colorless ...
IUPAC 名称2-methylpropyl 2-chloropropanoateChemical name computed from chemical structure that uses International Union of Pure and Applied Chemistry (IUPAC) nomenclature standards. InChIInChI=1S/C7H13ClO2/c1-5(2)4-10-7(9)6(3)8/h5-6H,4H2,1-3H3International Chemical Identifier (InChI) computed...
What carboxylic acid and alcohol is needed to produce isobutyl propionate? What is the major product of electrophilic addition of HBr to the following alkene? Explain your choice. What is the IUPAC name of the expected major product formed upon reaction of...
Name: 2-methylpropyl 2-hydroxybenzoate CAS Number: 87-19-4 3D/inchi ECHA EINECS - REACH Pre-Reg: 201-729-9 FDA UNII: S122C080GX Nikkaji Web: J36.460F Beilstein Number: 2615955 MDL: MFCD00020035 CoE Number: 434 XlogP3: 3.90 (est) Molecular Weight: 194.23018000 Formula: C11 H14 O3 ...