How to sequence tryptic peptides using low energy CID dataJohnson, By Rich
If the mRNA sequence is GGCAAG, what is the anticodon sequence? Please write the nucleotide sequence without any spaces. How is mRNA synthesized from DNA? What is a sequence of mRNA that codes for an amino acid called? How could this mRNA sequence support a triplet code? ACACACACACAC...
Second, using ChemAxon Marvin'smolconvertcommand /Applications/MarvinSuite/bin/molconvert --peptide MKGK smiles I get: [H]N[C@@H](CCSC)C(=O)N[C@@H](CCCCN)C(=O)NCC(=O)N[C@@H](CCCCN)C(O)=O Both of them give different result. Are they chemically the same?If not, whi...
How to Choose a Good ELISA Kiton January 03, 2023 Categories: Applications, ELISA Views: 825 The ELISA (enzyme-linked immunosorbent assay) is recognized by scientists for its many advantages. The assay is convenient, quick, and simple to execute. ELISA’s versatility to detect peptides, ...
Protein or peptide antigen? Advantages and disadvantages Want to upgrade your immunofluorescence workflow? Go Direct! Secondary antibody selection Why are recombinant Nanobodies/ VHHs beneficial? How to write a good scientific abstract? Learn how to save precious hours on your IP, IF, and western ...
How do amino acids react to form proteins? What is the first step in the folding of disordered polypeptide chains into stable proteins? How are the amino acid units in a polypeptide joined together? What are the links called? The pept...
Red blood cells are the most common type of cell in our blood. They pick up oxygen from our lungs and carry it to our tissue cells. allinonemovie, Pixabay License Blood Clotting, or Coagulation Blood clotting, or coagulation, is a biological process that stops bleeding. It's vital that bl...
protein fold the main research to have certain amino acid sequence multi-peptide chain to form the protein unique space conformation.Some outside factor like temperature, the solvent, pH, the ion intensity and so on can affect the protein the fold, causes its part or loses the biology a ...
(JA) and its derivatives comprise a group of plant hormones that were discovered recently, compared to auxin, abscisic acid, cytokinins, gibberellic acid, and ethylene. Nevertheless, there have been tremendous advances in JA research, following the general progression outlined above and parallel ...
How many different proteins, each with a unique amino acid sequence, can be constructed with a length of 8 amino acids?Amino Acid Sequence :An amino acid sequence is the specific, linear arrangement of amino acids of a peptide or protein. In nat...