Given the name of of the following compound. PBr3 Name the following compound listed below: (FeOH(H_2O)_5)Cl_2 Give the name of the compound As_2O_3. Name the ionic compound for MgO. Name the given compound. MgCl2 Name the given compound. KBrO3 ...
Given the name of of the following compound. PBr3 Give the name of the following compound: CH3CCH3 Give a systematic name for the depicted compound. Na2(Co(OH2)2(OH)4) Write the name of the compound ...
Name each compound by ionic, hydrogen, or molecular compound. P2O3, MnO2, Al2S3, SO3, NH3, SrI2, Cl2O5, FeCl2, BeH2 Deduce the name of the given compound. C5H12 Give the name of the binary compound CO2. Name the following binary covalent compounds: 1. NO2 2. PBr3 Name the bina...
Write the name and formula for the compound formed between Mg2+ and ClO2-. Name the following compound: CH_3CH_2CH_2OCH_2CH(CH_3)_2. Given the name of of the following compound. PBr3 Name the compound Ca3N2. What is the name of the compound with the formula Al2O3? Identify the ...
Name the following compound: CH3-O-CH2-CH3 Give the name of the compound PF5. Given the name of of the following compound. PBr3 Write the name of the following compound CH3-C-(CH3)2-CH2-C-(CH2-CH3)2-CH2-CH2-OH. Give the name of the compound XeF2. Give the name of the compound...
Name the following binary covalent compounds: 1. NO2 2. PBr3 Name the binary compound: Al_2S_2. What is the formula and the name of the binary compound formed by Ba and I? Name the binary compound: Ag_2S. Give the name of the binary compound CO2. Name the binary compound: LiH. ...