The balanced chemical equations are shown below. a) HCl with NaOH {eq}HCl + NaOH \rightarrow NaCl + H_2O{/eq} The equation is balanced as is. ... See full answer below.Become a member and unlock all Study Answers Start today. Try it now ...
Complete and balance the following equation: Zn(s) + HCl(aq) arrow Complete and balance this neutralization reaction: NaOH(aq) + HCl(aq) arrow Determine whether or not the following reaction occurs. If it does, write the balanced equation. Cu(s) + HC...
= NaCl + H + O must have the same number of atoms on each side of the equation. When using the inspection method (also known as the trial-and-error method), this principle is used to balance one element at a time until both sides are equal and the chemical equation is balanced. ...
To be balanced, every element in Al + HCl = AlCl3 + H2 must have the same number of atoms on each side of the equation. When using the inspection method (also known as the trial-and-error method), this principle is used to balance one element at a time until both sides are equal ...
Since there are an equal number of atoms of each element on both sides, the equation is balanced. 4Co(OH)2+10HCl +22NH3+ O2=2((NH3)5CoNH2Co(NH3)5)Cl5+10H2O Practice Balancing Co(OH)2-++HCl-++NH3-++O2-+ = ((NH3)5CoNH2Co(NH3)5)Cl5-++...
To be balanced, every element in HCl + Fe(NO3)2 = Fe(NO3)3 + FeCl3 + N2 + H2O must have the same number of atoms on each side of the equation. When using the inspection method (also known as the trial-and-error method), this principle is used to bala...
If you would like to attempt to guess the next steps, the final element counts in the balanced equation should be: Mn + 2CuCl2 + 2H2O = MnCl2 + H2 + 2CuOHCl ReactantsProducts Mn 1 1 ✔️ Cu 2 2 ✔️ Cl 4 4 ✔️ H 4 4 ✔️ O 2 2 ✔...
To be balanced, every element in (Cu(NH3)4)SO4 + HCl = ClH4N + CuO4S must have the same number of atoms on each side of the equation. When using the inspection method (also known as the trial-and-error method), this principle is used to balance one element at a time...
Recently Balanced EquationsBalance Al + HCl + CuSO4 = Al2(SO4)3 + CuCl2 + H2 Using the Algebraic Method To balance the equation Al + HCl + CuSO4 = Al2(SO4)3 + CuCl2 + H2 using the algebraic method step-by-step, you must have experience solving systems of li...
CuS + KMnO4 + H2O = MnO2 + HKO + CuO4S NaNo2 + HCl = NaCl + HNo2 Recently Balanced EquationsBalance Al + HCl + CuSO4 = Al2(SO4)3 + CuCl + H2 Using the Algebraic Method To balance the equation Al + HCl + CuSO4 = Al2(SO4)3 + CuCl + H2 using the...